Methyl 6-bromopicolinate
- Product NameMethyl 6-bromopicolinate
- CAS26218-75-7
- MFC7H6BrNO2
- MW216.03
- EINECS627-687-5
- MOL File26218-75-7.mol
Chemical Properties
| Melting point | 92-96 °C(lit.) |
| Boiling point | 289.7±20.0 °C(Predicted) |
| Density | 1.579±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | -1.03±0.10(Predicted) |
| form | Crystalline Powder or Needles |
| color | White to pale pink to pale brown to yellow |
| InChI | InChI=1S/C7H6BrNO2/c1-11-7(10)5-3-2-4-6(8)9-5/h2-4H,1H3 |
| InChIKey | SGNCOKUHMXLGAH-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 26218-75-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |