1,2,3,4-Tetrafluorobenzene
- Product Name1,2,3,4-Tetrafluorobenzene
- CAS551-62-2
- MFC6H2F4
- MW150.07
- EINECS208-997-6
- MOL File551-62-2.mol
Chemical Properties
| Melting point | -42 °C |
| Boiling point | 94 °C |
| Density | 1.43 |
| refractive index | 1.41 |
| Flash point | 20 °C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.400 |
| BRN | 1910024 |
| Stability | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 551-62-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2,3,4-tetrafluoro-(551-62-2) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36/37/39-33-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2903999090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
