N-Benzylcinchonidinium chloride
- Product NameN-Benzylcinchonidinium chloride
- CAS69257-04-1
- MFC26H29ClN2O
- MW420.97
- EINECS273-938-3
- MOL File69257-04-1.mol
Chemical Properties
| Melting point | 210 °C (dec.)(lit.) |
| alpha | -188 º (c=0.4% in H2O) |
| refractive index | -184 ° (C=1, H2O) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| optical activity | [α]20/D 180°, c = 1.3 in H2O |
| BRN | 5421832 |
| InChIKey | FCHYSBWCOKEPNQ-WOIURNJWSA-M |
| SMILES | [N+]12(CC[C@]([H])([C@@H](C=C)C1)C[C@@]2([H])[C@H](O)C1=CC=NC2C=CC=CC1=2)CC1C=CC=CC=1.[Cl-] |&1:3,5,10,12,r| |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 29392000 |
