3-(2-Bromophenyl)propionic acid
- Product Name3-(2-Bromophenyl)propionic acid
- CAS15115-58-9
- MFC9H9BrO2
- MW229.07
- EINECS
- MOL File15115-58-9.mol
Chemical Properties
| Melting point | 98-102 °C (lit.) |
| Boiling point | 186°C/15mmHg(lit.) |
| Density | 1.531±0.06 g/cm3(Predicted) |
| refractive index | 1.579 |
| Flash point | 154.0±20.9 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.60±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H9BrO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChIKey | AOACQJFIGWNQBC-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC=C1Br |
| CAS DataBase Reference | 15115-58-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
