3-(Trifluoromethoxy)benzyl bromide
- Product Name3-(Trifluoromethoxy)benzyl bromide
- CAS159689-88-0
- MFC8H6BrF3O
- MW255.03
- EINECS
- MOL File159689-88-0.mol
Chemical Properties
| Boiling point | 179 °C(lit.) |
| Density | 1.572 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 192 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.5838 |
| Sensitive | Lachrymatory |
| BRN | 8052203 |
| InChI | InChI=1S/C8H6BrF3O/c9-5-6-2-1-3-7(4-6)13-8(10,11)12/h1-4H,5H2 |
| InChIKey | QSIVWRRHVXSDNE-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 159689-88-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
