3-(Trifluoromethoxy)cinnamic acid
- Product Name3-(Trifluoromethoxy)cinnamic acid
- CAS168833-80-5
- MFC10H7F3O3
- MW232.16
- EINECS625-131-6
- MOL File168833-80-5.mol
Chemical Properties
| Melting point | 92-96 °C (lit.) |
| Boiling point | 286℃ |
| Density | 1.403 |
| Flash point | 127℃ |
| storage temp. | Store at room temperature |
| solubility | very faint turbidity in Methanol |
| form | powder to crystal |
| pka | 4.27±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C10H7F3O3/c11-10(12,13)16-8-3-1-2-7(6-8)4-5-9(14)15/h1-6H,(H,14,15)/b5-4+ |
| InChIKey | CLKZZEYGXRWYNI-SNAWJCMRSA-N |
| SMILES | [H]\C(=C(\[H])c1cccc(OC(F)(F)F)c1)C(O)=O |
| CAS DataBase Reference | 168833-80-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-26/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |