4-Bromo-2,6-dimethylphenol
- Product Name4-Bromo-2,6-dimethylphenol
- CAS2374-05-2
- MFC8H9BrO
- MW201.06
- EINECS219-153-1
- MOL File2374-05-2.mol
Chemical Properties
| Melting point | 74-78 °C (lit.) |
| Boiling point | 195.33°C (rough estimate) |
| Density | 1.3646 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 10.10±0.23(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 1862399 |
| InChI | InChI=1S/C8H9BrO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| InChIKey | ZLVFYUORUHNMBO-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C)C=C(Br)C=C1C |
| CAS DataBase Reference | 2374-05-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-bromo-2,6-dimethyl-(2374-05-2) |
| EPA Substance Registry System | Phenol, 4-bromo-2,6-dimethyl- (2374-05-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ZE6780000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |