4-Bromo-2,6-dimethylanisole
- Product Name4-Bromo-2,6-dimethylanisole
- CAS14804-38-7
- MFC9H11BrO
- MW215.09
- EINECS626-644-8
- MOL File14804-38-7.mol
Chemical Properties
| Boiling point | 117-120 °C/13 mmHg (lit.) |
| Density | 1.347 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Sensitive | Light Sensitive |
| BRN | 1940290 |
| InChI | InChI=1S/C9H11BrO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,1-3H3 |
| InChIKey | MMARFGDTMJBIBK-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(Br)=CC(C)=C1OC |
| CAS DataBase Reference | 14804-38-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29093090 |
