2,6-Dimethylbenzoquinone
- Product Name2,6-Dimethylbenzoquinone
- CAS527-61-7
- MFC8H8O2
- MW136.15
- EINECS208-420-8
- MOL File527-61-7.mol
Chemical Properties
| Melting point | 71-73 °C(lit.) |
| Boiling point | 201℃ |
| Density | 1.115 |
| refractive index | 1. |
| Flash point | 71℃ |
| form | Needle-Like Crystalline Solid |
| color | Yellow to brown |
| Water Solubility | Soluble in chloroform. Insoluble in water. |
| BRN | 2041345 |
| Stability | Stable. Combustible. Incompatible with oxidizing agents. |
| InChI | InChI=1S/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| InChIKey | SENUUPBBLQWHMF-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C)=CC(=O)C=C1C |
| CAS DataBase Reference | 527-61-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| RTECS | DK4825000 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |