| Melting point |
154°C |
| Boiling point |
193.57°C (rough estimate) |
| Density |
1.0340 (rough estimate) |
| refractive index |
1.4698 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
10.92±0.23(Predicted) |
| color |
White to Light yellow to Light red |
| InChI |
InChI=1S/C8H10O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4,9-10H,1-2H3 |
| InChIKey |
SGWZVZZVXOJRAQ-UHFFFAOYSA-N |
| SMILES |
C1(O)=C(C)C=C(O)C=C1C |
| CAS DataBase Reference |
654-42-2(CAS DataBase Reference) |
| EPA Substance Registry System |
1,4-Benzenediol, 2,6-dimethyl- (654-42-2) |
