4-Bromo-2,6-di-tert-butylphenol
- Product Name4-Bromo-2,6-di-tert-butylphenol
- CAS1139-52-2
- MFC14H21BrO
- MW285.22
- EINECS214-521-8
- MOL File1139-52-2.mol
Chemical Properties
| Melting point | 78-83 °C (dec.)(lit.) |
| Boiling point | 128 °C / 4mmHg |
| Density | 1.2457 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 11.23±0.40(Predicted) |
| color | White to Orange to Green |
| BRN | 2051052 |
| InChI | 1S/C14H21BrO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3 |
| InChIKey | SSQQUEKFNSJLKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)cc(c1O)C(C)(C)C |
| CAS DataBase Reference | 1139-52-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |