| Melting point |
218 °C (dec.)(lit.) |
| Boiling point |
642.8±55.0 °C(Predicted) |
| Density |
1.684±0.06 g/cm3(Predicted) |
| storage temp. |
room temp |
| solubility |
Slightly soluble in water, ethanol; soluble in ethyl acetate |
| pka |
7.0(at 25℃) |
| form |
Crystalline Powder |
| color |
Purple |
| PH Range |
5.7(yellow)-7.5(blue) |
| PH |
6.0-7.6, yellow to blue |
| ε(extinction coefficient) |
≥16000 at 417-421nm in methanol at 0.016g/L |
| λmax |
417nm |
| BRN |
369060 |
| Major Application |
Optical lenses, sol-gel matrix, inks, paints, toys, lubricants, cosmetics, food storage, microorganism detector, determination of drugs, diagnosis of multiple diseases |
| InChI |
1S/C23H20Br2O5S/c1-11-9-16(13(3)19(24)21(11)26)23(17-10-12(2)22(27)20(25)14(17)4)15-7-5-6-8-18(15)31(28,29)30-23/h5-10,26-27H,1-4H3 |
| InChIKey |
MRDOFVRMTNWMDA-UHFFFAOYSA-N |
| SMILES |
Cc1cc(c(C)c(Br)c1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c(O)c(Br)c4C |
| CAS DataBase Reference |
40070-59-5 |
