| Melting point |
205 °C (dec.)(lit.) |
| storage temp. |
2-8°C |
| solubility |
acetonitrile: 0.1 g/mL, clear |
| form |
Powder |
| color |
White to Almost white |
| Water Solubility |
Soluble in acetonitrile (100 mg/ml, clear, colorless), DMF (160.55 mg/ml, clear), and water (3 mg/ml at 20°C). |
| Sensitive |
Moisture Sensitive |
| BRN |
7066325 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C11H16N5O.BF4/c1-13(2)11(14(3)4)15-9-7-5-6-8-10(9)16(17)12-15;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 |
| InChIKey |
NQGZJNPFMLJDKU-UHFFFAOYSA-M |
| SMILES |
[B+3]([F-])([F-])([F-])[F-].C(=[N+]1/N=N(=O)C2=CC=CC=C/12)(\N(C)C)/N(C)C |
| LogP |
-2.65 at 21℃ |
| CAS DataBase Reference |
125700-67-6(CAS DataBase Reference) |
| EPA Substance Registry System |
1H-Benzotriazolium, 1-[bis(dimethylamino)methylene]-, 3-oxide, tetrafluoroborate(1-) (1:1) (125700-67-6) |
