TBTU
- Product NameTBTU
- CAS125700-67-6
- CBNumberCB3357547
- MFC11H16BF4N5O
- MW321.09
- EINECS603-087-9
- MDL NumberMFCD00077413
- MOL File125700-67-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 205 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear |
| form | Powder |
| color | White to Almost white |
| Water Solubility | Soluble in acetonitrile (100 mg/ml, clear, colorless), DMF (160.55 mg/ml, clear), and water (3 mg/ml at 20°C). |
| Sensitive | Moisture Sensitive |
| BRN | 7066325 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H16N5O.BF4/c1-13(2)11(14(3)4)15-9-7-5-6-8-10(9)16(17)12-15;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | NQGZJNPFMLJDKU-UHFFFAOYSA-M |
| SMILES | [B+3]([F-])([F-])([F-])[F-].C(=[N+]1/N=N(=O)C2=CC=CC=C/12)(\N(C)C)/N(C)C |
| LogP | -2.65 at 21℃ |
| CAS DataBase Reference | 125700-67-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Benzotriazolium, 1-[bis(dimethylamino)methylene]-, 3-oxide, tetrafluoroborate(1-) (1:1) (125700-67-6) |
| UNSPSC Code | 12352107 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P240-P241-P261-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,F,E | |||||||||
| Risk Statements | 36/37/38-5-2 | |||||||||
| Safety Statements | 26-36-37/39-36/37/39-35 | |||||||||
| RIDADR | 1325 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10-21 | |||||||||
| Hazard Note | Irritant/Flammable | |||||||||
| HS Code | 2933 99 80 | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | Ⅱ | |||||||||
| Storage Class | 4.1A - Other explosive hazardous materials | |||||||||
| Hazard Classifications | Flam. Sol. 1 Skin Sens. 1A | |||||||||
| NFPA 704: |
|
