O-(6-Chlorobenzotriazol-1-yl)-N,N,N',N'-tetramethyluronium tetrafluoroborate
- Product NameO-(6-Chlorobenzotriazol-1-yl)-N,N,N',N'-tetramethyluronium tetrafluoroborate
- CAS330641-16-2
- MFC11H15BClF4N5O
- MW355.53
- EINECS
- MOL File330641-16-2.mol
Chemical Properties
| Melting point | 201-205 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMF: 10%, clear |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H15ClN5O.BF4/c1-14(2)11(15(3)4)16-9-6-5-8(12)7-10(9)17(18)13-16;2-1(3,4)5/h5-7H,1-4H3;/q+1;-1 |
| InChIKey | LWGUJGKYJYAQDC-UHFFFAOYSA-N |
| SMILES | [B+3]([F-])([F-])([F-])[F-].C(=[N+]1/N=N(=O)C2=CC(Cl)=CC=C/12)(\N(C)C)/N(C)C |
| CAS DataBase Reference | 330641-16-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-60-37 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 Skin Sens. 1A |