3-Chloro-2-methylbenzoic acid
- Product Name3-Chloro-2-methylbenzoic acid
- CAS7499-08-3
- MFC8H7ClO2
- MW170.59
- EINECS626-731-0
- MOL File7499-08-3.mol
Chemical Properties
| Melting point | 163-166 °C (lit.) |
| Boiling point | 290.9±20.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1072826 |
| InChI | InChI=1S/C8H7ClO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | HXGHMCLCSPQMOR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1C |
| CAS DataBase Reference | 7499-08-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XU1645000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |