Iodoacetic acid sodium salt
- Product NameIodoacetic acid sodium salt
- CAS305-53-3
- MFC2H2INaO2
- MW207.93
- EINECS206-165-7
- MOL File305-53-3.mol
Chemical Properties
| Melting point | 208 °C (dec.)(lit.) |
| storage temp. | -20°C |
| solubility | methanol: 0.1 M at 20 °C, clear, colorless |
| form | Powder |
| color | Light yellow to yellow-brown |
| biological source | synthetic (organic) |
| Water Solubility | water: 100mg/mL |
| BRN | 4009322 |
| InChI | InChI=1S/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | AGDSCTQQXMDDCV-UHFFFAOYSA-M |
| SMILES | C([O-])(=O)CI.[Na+] |
| CAS DataBase Reference | 305-53-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, iodo-, sodium salt (305-53-3) |
| Absorption | cut-off at 335nm in methanol at 0.1M |
Safety Information
| Hazard Codes | T,Xn |
| Risk Statements | 25-37/38-41-20/21/22-36/37/38 |
| Safety Statements | 26-39-45-36-36/37/39-22 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AI3675000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
