Sodium hexafluorophosphate
- Product NameSodium hexafluorophosphate
- CAS21324-39-0
- MFF6NaP
- MW167.95
- EINECS244-333-1
- MOL File21324-39-0.mol
Chemical Properties
| Melting point | >200 °C (lit.) |
| Density | 2.369 g/mL at 25 °C (lit.) |
| storage temp. | Store at room temperature, keep dry and cool |
| solubility | H2O: soluble5%, clear, colorless |
| form | Crystals |
| color | White to light gray |
| Specific Gravity | 3.375 |
| PH | 2.0-4.0 |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| Stability | Stable. Incompatible with strong acids. |
| Major Application | battery manufacturing |
| InChI | InChI=1S/F6P.Na/c1-7(2,3,4,5)6;/q-1;+1 |
| InChIKey | KMADQUOCJBLXRP-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[Na+] |
| CAS DataBase Reference | 21324-39-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
