Sodium hexafluorophosphate
- Product NameSodium hexafluorophosphate
- CAS21324-39-0
- CBNumberCB0145930
- MFF6NaP
- MW167.95
- EINECS244-333-1
- MDL NumberMFCD00011122
- MOL File21324-39-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >200 °C (lit.) |
| Density | 2.369 g/mL at 25 °C (lit.) |
| storage temp. | Store at room temperature, keep dry and cool |
| solubility | H2O: soluble5%, clear, colorless |
| form | Crystals |
| color | White to light gray |
| Specific Gravity | 3.375 |
| PH | 2.0-4.0 |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| Stability | Stable. Incompatible with strong acids. |
| Major Application | battery manufacturing |
| InChI | InChI=1S/F6P.Na/c1-7(2,3,4,5)6;/q-1;+1 |
| InChIKey | KMADQUOCJBLXRP-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[Na+] |
| CAS DataBase Reference | 21324-39-0(CAS DataBase Reference) |
| UNSPSC Code | 12352600 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H314 | |||||||||
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 20/21/22-34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3260 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 28269090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
