4-Methyl-3-nitrobenzene-1-sulfonyl chloride
- Product Name4-Methyl-3-nitrobenzene-1-sulfonyl chloride
- CAS616-83-1
- MFC7H6ClNO4S
- MW235.64
- EINECS626-209-2
- MOL File616-83-1.mol
Chemical Properties
| Melting point | 30-34 °C (lit.) |
| Boiling point | 152-154°C 1mm |
| Density | 1.528±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow to Green |
| Sensitive | Moisture Sensitive |
| BRN | 2696481 |
| InChI | InChI=1S/C7H6ClNO4S/c1-5-2-3-6(14(8,12)13)4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | OQFYBGANSUNUAO-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(C)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 616-83-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34-29-14 |
| Safety Statements | 26-36/37/39-45-8-30-22 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 2904.99.4700 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
