| Melting point |
159-160 °C (lit.) |
| Boiling point |
345.65°C (rough estimate) |
| Density |
1.2377 (rough estimate) |
| refractive index |
1.5380 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
Soluble in hot toluene. (almost transparency) |
| form |
Powder or Chunks |
| color |
Light yellow to yellow |
| BRN |
1912752 |
| Henry's Law Constant |
4.3×102 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| InChI |
InChI=1S/C14H7ClO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H |
| InChIKey |
BOCJQSFSGAZAPQ-UHFFFAOYSA-N |
| SMILES |
C1(Cl)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| CAS DataBase Reference |
82-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
9,10-Anthracenedione, 1-chloro-(82-44-0) |
| EPA Substance Registry System |
1-Chloroanthraquinone (82-44-0) |
