| Melting point |
209-211 °C (lit.) |
| Boiling point |
345.65°C (rough estimate) |
| Density |
1.2377 (rough estimate) |
| refractive index |
1.5380 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| color |
White to Light orange to Yellow |
| Water Solubility |
insoluble |
| BRN |
2051842 |
| Henry's Law Constant |
4.2×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI |
InChI=1S/C14H7ClO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H |
| InChIKey |
FPKCTSIVDAWGFA-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1Cl |
| CAS DataBase Reference |
131-09-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Chloroanthraquinone(131-09-9) |
| EPA Substance Registry System |
9,10-Anthracenedione, 2-chloro- (131-09-9) |
