Dihydrocapsaicin
- Product NameDihydrocapsaicin
- CAS19408-84-5
- MFC18H29NO3
- MW307.43
- EINECS606-308-7
- MOL File19408-84-5.mol
Chemical Properties
| Melting point | 62-65 °C(lit.) |
| Boiling point | 497.4±35.0 °C(Predicted) |
| Density | 1.026±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | H2O: insoluble |
| pka | 9.76±0.20(Predicted) |
| form | White to off-white solid. |
| color | White to off-white |
| BRN | 2815150 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21) |
| InChIKey | XJQPQKLURWNAAH-UHFFFAOYSA-N |
| SMILES | C(NCC1=CC=C(O)C(OC)=C1)(=O)CCCCCCC(C)C |
| LogP | 3.556 (est) |
| CAS DataBase Reference | 19408-84-5(CAS DataBase Reference) |
| EPA Substance Registry System | Dihydrocapsaicin (19408-84-5) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-37/38-41-42/43-36/37/38 |
| Safety Statements | 22-26-28-36/39-45-36/37/39 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | RA8530000 |
| F | 10-21 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29399990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
