N,N-Diethyl-m-toluidine
- Product NameN,N-Diethyl-m-toluidine
- CAS91-67-8
- MFC11H17N
- MW163.26
- EINECS202-089-3
- MOL File91-67-8.mol
Chemical Properties
| Melting point | 46.25°C (estimate) |
| Boiling point | 97 °C (17 mmHg) |
| Density | 0.92 |
| refractive index | 1.535-1.537 |
| Flash point | 101 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 6.84±0.30(Predicted) |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | CIPVVROJHKLHJI-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=CC(C)=C1 |
| CAS DataBase Reference | 91-67-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, N,N-diethyl-3-methyl-(91-67-8) |
| EPA Substance Registry System | Benzenamine, N,N-diethyl-3-methyl- (91-67-8) |
Safety Information
| Hazard Codes | Xn,N,T |
| Risk Statements | 36/37/38-20/21/22-51/53-26-24/25-20 |
| Safety Statements | 24/25-61-45-36/37-28 |
| RIDADR | UN 1708 6.1/PG 2 |
| RTECS | CX9869375 |
| HS Code | 29214300 |
