| Melting point |
50-52° |
| Boiling point |
451.1±55.0 °C(Predicted) |
| Density |
1.34±0.1 g/cm3(Predicted) |
| vapor pressure |
0-0.001Pa at 20-50℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| pka |
-5.89±0.70(Predicted) |
| form |
Solid |
| color |
Off-White to Light Beige |
| Water Solubility |
Water: < 0.1 mg/mL (insoluble) |
| InChI |
InChI=1S/C16H18Cl2N2O4/c1-4-23-14(21)12-9-16(3,15(22)24-5-2)20(19-12)13-7-6-10(17)8-11(13)18/h6-8H,4-5,9H2,1-3H3 |
| InChIKey |
OPGCOAPTHCZZIW-UHFFFAOYSA-N |
| SMILES |
N1(C2=CC=C(Cl)C=C2Cl)C(C)(C(OCC)=O)CC(C(OCC)=O)=N1 |
| LogP |
4 at 25℃ and pH4-9 |
| CAS DataBase Reference |
135590-91-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Mefenpyr-diethyl(135590-91-9) |
| EPA Substance Registry System |
Mefenpyr-diethyl (135590-91-9) |
