N,N-Diethyl-m-toluidine
- Product NameN,N-Diethyl-m-toluidine
- CAS91-67-8
- CBNumberCB2756675
- MFC11H17N
- MW163.26
- EINECS202-089-3
- MDL NumberMFCD00035795
- MOL File91-67-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 46.25°C (estimate) |
| Boiling point | 97 °C (17 mmHg) |
| Density | 0.92 |
| refractive index | 1.535-1.537 |
| Flash point | 101 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 6.84±0.30(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | CIPVVROJHKLHJI-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=CC(C)=C1 |
| CAS DataBase Reference | 91-67-8(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | E5635R949A |
| NIST Chemistry Reference | Benzenamine, N,N-diethyl-3-methyl-(91-67-8) |
| EPA Substance Registry System | Benzenamine, N,N-diethyl-3-methyl- (91-67-8) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H311-H331-H411-H302+H312+H332-H315-H319 | |||||||||
| Precautionary statements | P261-P273-P280-P301+P310-P311-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 | |||||||||
| Hazard Codes | Xn,N,T | |||||||||
| Risk Statements | 36/37/38-20/21/22-51/53-26-24/25-20 | |||||||||
| Safety Statements | 24/25-61-45-36/37-28 | |||||||||
| RIDADR | UN 1708 6.1/PG 2 | |||||||||
| WGK Germany | WGK 2 | |||||||||
| RTECS | CX9869375 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29214300 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 | |||||||||
| NFPA 704: |
|
