Chemical Properties
| Melting point | 205-210 °C (dec.)(lit.) |
| storage temp. | -20°C Freezer |
| solubility | H2O: soluble1mg/mL |
| Colour Index | 52010 |
| form | Powder |
| color | Dark green |
| Water Solubility | Soluble |
| λmax | 648–655 nm |
| ε(extinction coefficient) | ≥13000 at 241-247nm ≥36000 at 287-293nm ≥67000 at 638-644nm |
| Merck | 14,6058 |
| BRN | 3922630 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| Biological Applications | Antimalarial; biofuel cell; medical devices; diagnosis of amyloid accumulation related diseases,diabetes,malignant melanoma; detecting oral cancer,cells,nucleic acids; treating avian influenza virus,nail infection,oral cavity infection |
| InChI | 1S/C15H15N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9H,1-3H3;1H |
| InChIKey | DNDJEIWCTMMZBX-UHFFFAOYSA-N |
| SMILES | C[N+](C)=C(C=C1)C=C(C1=N2)SC3=C2C=CC(NC)=C3.[Cl-] |
| CAS DataBase Reference | 531-55-5(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | SO5550000 |
| HS Code | 32129000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
