| Melting point |
213 °C |
| Boiling point |
383.7±15.0 °C(Predicted) |
| Density |
1.35±0.1 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| pka |
3.14±0.10(Predicted) |
| form |
Solid |
| color |
White to Off White |
| Water Solubility |
Insoluble in water. Soluble in DMSO and Methanol. |
| InChI |
InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(10-11)9(12)13/h2-5H,1H3,(H,12,13) |
| InChIKey |
OVVDFORZEGKEJM-UHFFFAOYSA-N |
| SMILES |
N1(C)C2=C(C=CC=C2)C(C(O)=O)=N1 |
| CAS DataBase Reference |
50890-83-0(CAS DataBase Reference) |
