N-(Methoxymethyl)-N-(trimethylsilylmethyl)benzylamine
- Product NameN-(Methoxymethyl)-N-(trimethylsilylmethyl)benzylamine
- CAS93102-05-7
- MFC13H23NOSi
- MW237.41
- EINECS630-326-4
- MOL File93102-05-7.mol
Chemical Properties
| Boiling point | 76 °C0.3 mm Hg(lit.) |
| Density | 0.928 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 151 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, ethyl acetate. |
| form | Liquid |
| pka | 7.29±0.50(Predicted) |
| color | Clear colorless to light yellow |
| Specific Gravity | 0.928 |
| Sensitive | Moisture & Light Sensitive |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| BRN | 4311216 |
| InChI | 1S/C13H23NOSi/c1-15-11-14(12-16(2,3)4)10-13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3 |
| InChIKey | RPZAAFUKDPKTKP-UHFFFAOYSA-N |
| SMILES | COCN(Cc1ccccc1)C[Si](C)(C)C |
| CAS DataBase Reference | 93102-05-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
