(1S)-(-)-Camphanic acid
- Product Name(1S)-(-)-Camphanic acid
- CAS13429-83-9
- MFC10H14O4
- MW198.22
- EINECS236-552-6
- MOL File13429-83-9.mol
Chemical Properties
| Melting point | 201-205 °C |
| Boiling point | 255.53°C (rough estimate) |
| alpha | -18.5 º (c=1, dioxane) |
| Density | 1.0143 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.36±0.60(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| optical activity | [α]20/D 18°, c = 1 in dioxane |
| BRN | 84570 |
| InChI | InChI=1S/C10H14O4/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3,(H,11,12)/t9-,10+/m0/s1 |
| InChIKey | RKFCLVFAFZYVCG-WDEREUQCSA-N |
| SMILES | [C@@]12(C(O)=O)C(C)(C)[C@@](C)(CC1)C(=O)O2 |
| CAS DataBase Reference | 13429-83-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26-36-37 |
| WGK Germany | 3 |
| HS Code | 29329995 |
| Storage Class | 13 - Non Combustible Solids |
