5-Chloro-2-hydroxy-3-nitropyridine
- Product Name5-Chloro-2-hydroxy-3-nitropyridine
- CAS21427-61-2
- MFC5H3ClN2O3
- MW174.54
- EINECS622-609-6
- MOL File21427-61-2.mol
Chemical Properties
| Melting point | 232-236 °C |
| Boiling point | 284.1±40.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 6.31±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 383852 |
| InChI | 1S/C5H3ClN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) |
| InChIKey | QVGQNICXNZMXQA-UHFFFAOYSA-N |
| SMILES | Oc1ncc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 21427-61-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39-36-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
