(-)-Bis[(S)-1-phenylethyl]amine hydrochloride
- Product Name(-)-Bis[(S)-1-phenylethyl]amine hydrochloride
- CAS40648-92-8
- MFC16H19N.ClH
- MW261.79
- EINECS
- MOL File40648-92-8.mol
Chemical Properties
| Melting point | 261-263 °C(lit.) |
| refractive index | -73 ° (C=3, EtOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 73±2°, c = 3% in ethanol |
| BRN | 4723969 |
| InChI | InChI=1/C16H19N.ClH/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16;/h3-14,17H,1-2H3;1H/t13-,14-;/s3 |
| InChIKey | ZBQCLJZOKDRAOW-FGVWXQOBNA-N |
| SMILES | C1(=CC=CC=C1)[C@H](C)N[C@@H](C)C1=CC=CC=C1.Cl |&1:6,9,r| |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 2921.49.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |