N-Benzylcinchoninium chloride
- Product NameN-Benzylcinchoninium chloride
- CAS69221-14-3
- MFC26H29N2O.Cl
- MW420.98
- EINECS273-915-8
- MOL File69221-14-3.mol
Chemical Properties
| Melting point | 256 °C (dec.)(lit.) |
| refractive index | 168.5 ° (C=0.4, MeOH:H2O=1:5) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystaline |
| color | White to Almost white |
| optical activity | [α]20/D +169°, c = 0.4 in H2O |
| BRN | 5232950 |
| InChIKey | FCHYSBWCOKEPNQ-YGNISETGSA-M |
| SMILES | [Cl-].O[C@H]([C@H]1C[C@@H]2CC[N+]1(C[C@@H]2C=C)Cc3ccccc3)c4ccnc5ccccc45 |
| CAS DataBase Reference | 69221-14-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
