(4-Carboxybutyl)triphenylphosphonium bromide
- Product Name(4-Carboxybutyl)triphenylphosphonium bromide
- CAS17814-85-6
- MFC23H24BrO2P
- MW443.31
- EINECS241-782-5
- MOL File17814-85-6.mol
Chemical Properties
| Melting point | 204-207 °C(lit.) |
| Boiling point | 324.7-327.4℃ at 101.93-102.15kPa |
| bulk density | 360-400kg/m3 |
| Density | 1.371 at 20℃ |
| vapor pressure | 0Pa at 25℃ |
| Flash point | 195°(383°F) |
| storage temp. | Store below +30°C. |
| solubility | DMSO, Methanol, Water |
| form | solid |
| color | White to Off-White |
| Water Solubility | Soluble in ethanol, methanol and soluble water. Insoluble in toluene and hexane. |
| Sensitive | Hygroscopic |
| BRN | 3586477 |
| InChI | 1S/C23H23O2P.BrH/c24-23(25)18-10-11-19-26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17H,10-11,18-19H2;1H |
| InChIKey | KQJPHSBFOSLICV-UHFFFAOYSA-N |
| SMILES | [Br-].OC(=O)CCCC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| LogP | 0.146 |
| CAS DataBase Reference | 17814-85-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3278 |
| WGK Germany | 3 |
| HS Code | 29310095 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |