Quinoline-4-carboxylic acid
- Product NameQuinoline-4-carboxylic acid
- CAS486-74-8
- MFC10H7NO2
- MW173.17
- EINECS207-640-1
- MOL File486-74-8.mol
Chemical Properties
| Melting point | 254-255 °C (lit.) |
| Boiling point | 348.7±15.0 °C(Predicted) |
| Density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 1.03±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 5224 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) |
| InChIKey | VQMSRUREDGBWKT-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1 |
| CAS DataBase Reference | 486-74-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | GD3850000 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |