| Melting point |
250-252 °C (lit.) |
| Boiling point |
247.23°C (rough estimate) |
| Density |
1.2296 (rough estimate) |
| refractive index |
1.5880 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
11.94±0.20(Predicted) |
| form |
powder to crystal |
| color |
White to Light yellow to Light orange |
| λmax |
306nm(MeOH)(lit.) |
| BRN |
3733 |
| InChI |
InChI=1S/C7H6N2O/c10-7-5-3-1-2-4-6(5)8-9-7/h1-4H,(H2,8,9,10) |
| InChIKey |
SWEICGMKXPNXNU-UHFFFAOYSA-N |
| SMILES |
N1C2=C(C=CC=C2)C(=O)N1 |
| CAS DataBase Reference |
7364-25-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
3H-indazol-3-one, 1,2-dihydro-(7364-25-2) |
| EPA Substance Registry System |
3H-Indazol-3-one, 1,2-dihydro- (7364-25-2) |