Bis(tetrabutylammonium) dichromate
- Product NameBis(tetrabutylammonium) dichromate
- CAS56660-19-6
- MFC32H72Cr2N2O7
- MW700.92
- EINECS260-315-6
- MOL File56660-19-6.mol
Chemical Properties
| Melting point | 139-143 °C (lit.) |
| solubility | sol dichloromethane, chloroform. |
| form | powder to crystaline |
| color | Light yellow to Brown |
| Water Solubility | Soluble in water. |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | 1S/2C16H36N.2Cr.7O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;;;;;/h2*5-16H2,1-4H3;;;;;;;;;/q2*+1;;;;;;;;2*-1 |
| InChIKey | MMKQSIQNDMIVIN-UHFFFAOYSA-N |
| SMILES | [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC |
Safety Information
| Hazard Codes | O,T,N |
| Risk Statements | 49-8-43-50/53 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 2 |
| F | 8 |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Ox. Sol. 2 Skin Sens. 1 |