Bis(tetrabutylammonium) dichromate
- Product NameBis(tetrabutylammonium) dichromate
- CAS56660-19-6
- CBNumberCB2272092
- MFC32H72Cr2N2O7
- MW700.92
- EINECS260-315-6
- MDL NumberMFCD00013104
- MOL File56660-19-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 139-143 °C (lit.) |
| solubility | sol dichloromethane, chloroform. |
| form | powder to crystaline |
| color | Light yellow to Brown |
| Water Solubility | Soluble in water. |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | 1S/2C16H36N.2Cr.7O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;;;;;/h2*5-16H2,1-4H3;;;;;;;;;/q2*+1;;;;;;;;2*-1 |
| InChIKey | MMKQSIQNDMIVIN-UHFFFAOYSA-N |
| SMILES | [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC |
| UNSPSC Code | 12352116 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
   
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H272-H317-H350-H410 | |||||||||
| Precautionary statements | P202-P210-P273-P280-P302+P352-P308+P313 | |||||||||
| Hazard Codes | O,T,N | |||||||||
| Risk Statements | 49-8-43-50/53 | |||||||||
| Safety Statements | 53-45-60-61 | |||||||||
| RIDADR | UN 1479 5.1/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| F | 8 | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 5.1B - Oxidizing hazardous materials | |||||||||
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Ox. Sol. 2 Skin Sens. 1 | |||||||||
| NFPA 704: |
|
