Triethylene glycol diacrylate
- Product NameTriethylene glycol diacrylate
- CAS1680-21-3
- MFC12H18O6
- MW258.27
- EINECS216-853-9
- MOL File1680-21-3.mol
Chemical Properties
| Melting point | 125℃/2mm |
| Boiling point | 266°C |
| Density | 1,1 g/cm3 |
| refractive index | n20/D1.464 |
| Flash point | >100°C |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2 |
| InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N |
| SMILES | C(OCCOC(=O)C=C)COCCOC(=O)C=C |
| EPA Substance Registry System | Triethylene glycol diacrylate (1680-21-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43-36/38 |
| Safety Statements | 26-36/37/39-28 |
| WGK Germany | 3 |
| RTECS | AS8150000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Toxicity | LD50 orl-rat: 500 mg/kg 85GMAT -,115,82 |