Diethylene glycol diacrylate
- Product NameDiethylene glycol diacrylate
- CAS4074-88-8
- MFC10H14O5
- MW214.22
- EINECS223-791-6
- MOL File4074-88-8.mol
Chemical Properties
| Melting point | >200℃/760mm |
| Boiling point | 162 °C(lit.) |
| Density | 1.118 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Slightly soluble in water (1-5g/100ml at 18°C). |
| α-end | acrylate |
| Ω-end | acrylate |
| BRN | 1953711 |
| Henry's Law Constant | 1.0×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Stable. Incompatible with radical initiators, strong oxidizing agents, reducing agents, peroxides. Light sensitive. Polymerizes at elevated temperatures. |
| InChI | InChI=1S/C10H14O5/c1-3-9(11)14-7-5-13-6-8-15-10(12)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | LEJBBGNFPAFPKQ-UHFFFAOYSA-N |
| SMILES | O(CCOC(=O)C=C)CCOC(=O)C=C |
| CAS DataBase Reference | 4074-88-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 24-36/38-43 |
| Safety Statements | 28-39-45 |
| RIDADR | UN 2922 8/PG 3 |
| WGK Germany | 1 |
| RTECS | AS9450000 |
| TSCA | TSCA listed |
| HS Code | 2916.12.5050 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 4074-88-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 250mg/kg |
