2-Chloro-3-nitrotoluene
- Product Name2-Chloro-3-nitrotoluene
- CAS3970-40-9
- MFC7H6ClNO2
- MW171.58
- EINECS223-591-9
- MOL File3970-40-9.mol
Chemical Properties
| Melting point | 21 °C (lit.) |
| Boiling point | 147 °C/25 mmHg (lit.) |
| Density | 1.298 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | InChI=1S/C7H6ClNO2/c1-5-3-2-4-6(7(5)8)9(10)11/h2-4H,1H3 |
| InChIKey | XTSGZXRUCAWXKY-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 3970-40-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| RIDADR | UN 2433 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
