2,6-Dichloro-3-nitrotoluene
- Product Name2,6-Dichloro-3-nitrotoluene
- CAS29682-46-0
- MFC7H5Cl2NO2
- MW206.03
- EINECS249-776-4
- MOL File29682-46-0.mol
Chemical Properties
| Melting point | 53-56 °C (lit.) |
| Boiling point | 293.8±35.0 °C(Predicted) |
| Density | 1.4062 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point | >230 °F |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| BRN | 2259855 |
| InChI | 1S/C7H5Cl2NO2/c1-4-5(8)2-3-6(7(4)9)10(11)12/h2-3H,1H3 |
| InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc(c1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 29682-46-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29049095 |
| Storage Class | 11 - Combustible Solids |
