2-Chloro-3-nitrobenzoic acid
- Product Name2-Chloro-3-nitrobenzoic acid
- CAS3970-35-2
- MFC7H4ClNO4
- MW201.56
- EINECS223-590-3
- MOL File3970-35-2.mol
Chemical Properties
| Melting point | 183-187 °C (lit.) |
| Boiling point | 359.9±27.0 °C(Predicted) |
| Density | 1.6620 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | pK1: 2.02 (25°C) |
| color | White to cream-yellow with a green cast |
| BRN | 645427 |
| InChI | InChI=1S/C7H4ClNO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 3970-35-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
