2-Chloro-5-nitrobenzotrifluoride
- Product Name2-Chloro-5-nitrobenzotrifluoride
- CAS777-37-7
- MFC7H3ClF3NO2
- MW225.55
- EINECS212-287-1
- MOL File777-37-7.mol
Chemical Properties
| Melting point | 22°C |
| Boiling point | 108 °C/10 mmHg (lit.) |
| Density | 1.527 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 210 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Specific Gravity | 1.527 |
| FreezingPoint | 20.0 to 23.0 ℃ |
| BRN | 2216169 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C7H3ClF3NO2/c8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h1-3H |
| InChIKey | HQROXDLWVGFPDE-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(c1)C(F)(F)F |
| CAS DataBase Reference | 777-37-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-nitro-2-(trifluoromethyl)-(777-37-7) |
| EPA Substance Registry System | 2-Chloro-5-nitrobenzotrifluoride (777-37-7) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |