3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine
- Product Name3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine
- CAS149082-03-1
- MFC8H10N2O3
- MW182.18
- EINECS604-675-8
- MOL File149082-03-1.mol
Chemical Properties
| Melting point | 66-70 °C (lit.) |
| Boiling point | 349.7±37.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.97±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | 1S/C8H10N2O3/c1-5-3-9-7(4-11)6(2)8(5)10(12)13/h3,11H,4H2,1-2H3 |
| InChIKey | KBCDOXSSYLFMHH-UHFFFAOYSA-N |
| SMILES | Cc1cnc(CO)c(C)c1[N+]([O-])=O |
| CAS DataBase Reference | 149082-03-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
