Ethyl pyrazole-4-carboxylate
- Product NameEthyl pyrazole-4-carboxylate
- CAS37622-90-5
- MFC6H8N2O2
- MW140.14
- EINECS609-452-9
- MOL File37622-90-5.mol
Chemical Properties
| Melting point | 78-80 °C (lit.) |
| Boiling point | 138-140 °C/3 mmHg (lit.) |
| Density | 1.2850 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| Flash point | 138-140°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Miscible with acetone. |
| pka | 11.70±0.50(Predicted) |
| form | Crystalline Powder |
| color | White to pale yellow |
| InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-3-7-8-4-5/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | KACZQOKEFKFNDB-UHFFFAOYSA-N |
| SMILES | N1C=C(C(OCC)=O)C=N1 |
| LogP | 0.909 (est) |
| CAS DataBase Reference | 37622-90-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(C2H5COO)-pyrazole(37622-90-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |