Chemical Properties
| Melting point | 293-296°C (dec.) |
| Boiling point | 375.7°C (rough estimate) |
| Density | 1.3347 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 6.15±0.40(Predicted) |
| form | Solid |
| color | Light Yellow to Dark Yellow |
| BRN | 47741 |
| Stability | Hygroscopic |
| Major Application | food and beverages |
| InChI | 1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
| InChIKey | JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c3ccc(O)c(O)c3 |
| LogP | 2.580 (est) |
| CAS DataBase Reference | 90-19-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | LK8748000 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
