4'-Chloro-2',5'-dimethoxyacetoacetanilide
- Product Name4'-Chloro-2',5'-dimethoxyacetoacetanilide
- CAS4433-79-8
- MFC12H14ClNO4
- MW271.7
- EINECS224-638-6
- MOL File4433-79-8.mol
Chemical Properties
| Melting point | 102-104°C |
| Boiling point | 432.7±45.0 °C(Predicted) |
| Density | 1.277 |
| vapor pressure | 0-0.001Pa at 20-50℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 10.75±0.46(Predicted) |
| Colour Index | 37613 |
| form | Powder |
| color | White to Light yellow |
| InChI | InChI=1S/C12H14ClNO4/c1-7(15)4-12(16)14-9-6-10(17-2)8(13)5-11(9)18-3/h5-6H,4H2,1-3H3,(H,14,16) |
| InChIKey | MOUVJGIRLPZEES-UHFFFAOYSA-N |
| SMILES | C(NC1=CC(OC)=C(Cl)C=C1OC)(=O)CC(=O)C |
| LogP | 1.74 at 23℃ and pH6-8 |
| CAS DataBase Reference | 4433-79-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetoacetanilide, 4'-chloro-2',5'-dimethoxy-(4433-79-8) |
| EPA Substance Registry System | 2,5-Dimethoxy-4-chloroacetoacetanilide (4433-79-8) |
