1,3,5-Tris(bromomethyl)benzene
- Product Name1,3,5-Tris(bromomethyl)benzene
- CAS18226-42-1
- MFC9H9Br3
- MW356.88
- EINECS
- MOL File18226-42-1.mol
Chemical Properties
| Melting point | 94-99 °C |
| Boiling point | 352.2±37.0 °C(Predicted) |
| Density | 2.005±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C9H9Br3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3H,4-6H2 |
| InChIKey | GHITVUOBZBZMND-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(CBr)=CC(CBr)=C1 |
| CAS DataBase Reference | 18226-42-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
