1,3,5-Benzenetricarboxylic acid chloride
- Product Name1,3,5-Benzenetricarboxylic acid chloride
- CAS4422-95-1
- MFC9H3Cl3O3
- MW265.48
- EINECS224-594-8
- MOL File4422-95-1.mol
Chemical Properties
| Melting point | 35 °C |
| Boiling point | 181 °C/16 mmHg |
| Density | 1.487 g/mL at 25 °C (lit.) |
| refractive index | 1.5945-1.5965 |
| Flash point | 110 °C - closed cup |
| storage temp. | Store below +30°C. |
| solubility | decomposes |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light orange to Yellow |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 2940936 |
| InChI | 1S/C9H3Cl3O3/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15/h1-3H |
| InChIKey | UWCPYKQBIPYOLX-UHFFFAOYSA-N |
| SMILES | ClC(=O)c1cc(cc(c1)C(Cl)=O)C(Cl)=O |
| CAS DataBase Reference | 4422-95-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Benzenetricarbonyl trichloride(4422-95-1) |
| EPA Substance Registry System | 1,3,5-Benzenetricarbonyl trichloride (4422-95-1) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 14-22-34 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2917399090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
